C21H27N3O4 — CID 70414111
but-2-enedioic acid;1-(2-phenylethyl)-N-pyrrol-1-ylpiperidin-4-amine (PubChem CID 70414111) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is but-2-enedioic acid;1-(2-phenylethyl)-N-pyrrol-1-ylpiperidin-4-amine.
| Compound Name | but-2-enedioic acid;1-(2-phenylethyl)-N-pyrrol-1-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 70414111 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | but-2-enedioic acid;1-(2-phenylethyl)-N-pyrrol-1-ylpiperidin-4-amine |
| SMILES | O=C(O)C=CC(=O)O.c1ccc(CCN2CCC(Nn3cccc3)CC2)cc1 |
| InChI | InChI=1S/C17H23N3.C4H4O4/c1-2-6-16(7-3-1)8-13-19-14-9-17(10-15-19)18-20-11-4-5-12-20;5-3(6)1-2-4(7)8/h1-7,11-12,17-18H,8-10,13-15H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | WMTSNCMUSVZFTL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|