C16H24N2O2 — CID 95839205
(2R)-N,N,2-trimethyl-4-(2-phenylethyl)morpholine-2-carboxamide (PubChem CID 95839205) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2R)-N,N,2-trimethyl-4-(2-phenylethyl)morpholine-2-carboxamide.
| Compound Name | (2R)-N,N,2-trimethyl-4-(2-phenylethyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 95839205 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (2R)-N,N,2-trimethyl-4-(2-phenylethyl)morpholine-2-carboxamide |
| SMILES | CN(C)C(=O)[C@@]1(C)CN(CCc2ccccc2)CCO1 |
| InChI | InChI=1S/C16H24N2O2/c1-16(15(19)17(2)3)13-18(11-12-20-16)10-9-14-7-5-4-6-8-14/h4-8H,9-13H2,1-3H3/t16-/m1/s1 |
| InChIKey | YWSWLULBZMRJND-MRXNPFEDSA-N |
| XLogP | 1.41 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |