C15H22N2O4S — CID 124940760
(2R)-N-benzyl-N,2-dimethyl-4-methylsulfonylmorpholine-2-carboxamide (PubChem CID 124940760) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is (2R)-N-benzyl-N,2-dimethyl-4-methylsulfonylmorpholine-2-carboxamide.
| Compound Name | (2R)-N-benzyl-N,2-dimethyl-4-methylsulfonylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 124940760 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (2R)-N-benzyl-N,2-dimethyl-4-methylsulfonylmorpholine-2-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)[C@@]1(C)CN(S(C)(=O)=O)CCO1 |
| InChI | InChI=1S/C15H22N2O4S/c1-15(12-17(9-10-21-15)22(3,19)20)14(18)16(2)11-13-7-5-4-6-8-13/h4-8H,9-12H2,1-3H3/t15-/m1/s1 |
| InChIKey | AIJZOLKPYWHZEA-OAHLLOKOSA-N |
| XLogP | 0.70 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |