C19H23N3O2S — CID 155873086
3-anilino-N,N-dimethyl-1-(thiophene-3-carbonyl)piperidine-3-carboxamide (PubChem CID 155873086) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 3-anilino-N,N-dimethyl-1-(thiophene-3-carbonyl)piperidine-3-carboxamide.
| Compound Name | 3-anilino-N,N-dimethyl-1-(thiophene-3-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 155873086 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-anilino-N,N-dimethyl-1-(thiophene-3-carbonyl)piperidine-3-carboxamide |
| SMILES | CN(C)C(=O)C1(Nc2ccccc2)CCCN(C(=O)c2ccsc2)C1 |
| InChI | InChI=1S/C19H23N3O2S/c1-21(2)18(24)19(20-16-7-4-3-5-8-16)10-6-11-22(14-19)17(23)15-9-12-25-13-15/h3-5,7-9,12-13,20H,6,10-11,14H2,1-2H3 |
| InChIKey | HFWGMICRDFRTNE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |