C19H22N2O2S — CID 97489100
[(3R,5S)-3-anilino-1-oxa-9-azaspiro[4.5]decan-9-yl]-thiophen-3-ylmethanone (PubChem CID 97489100) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is [(3R,5S)-3-anilino-1-oxa-9-azaspiro[4.5]decan-9-yl]-thiophen-3-ylmethanone.
| Compound Name | [(3R,5S)-3-anilino-1-oxa-9-azaspiro[4.5]decan-9-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 97489100 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | [(3R,5S)-3-anilino-1-oxa-9-azaspiro[4.5]decan-9-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCC[C@]2(C[C@@H](Nc3ccccc3)CO2)C1 |
| InChI | InChI=1S/C19H22N2O2S/c22-18(15-7-10-24-13-15)21-9-4-8-19(14-21)11-17(12-23-19)20-16-5-2-1-3-6-16/h1-3,5-7,10,13,17,20H,4,8-9,11-12,14H2/t17-,19+/m1/s1 |
| InChIKey | FHASGJGEKPBILQ-MJGOQNOKSA-N |
| XLogP | 3.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |