C20H26N4O — CID 155879167
3-anilino-N,N-dimethyl-1-(pyridin-3-ylmethyl)piperidine-3-carboxamide (PubChem CID 155879167) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-anilino-N,N-dimethyl-1-(pyridin-3-ylmethyl)piperidine-3-carboxamide.
| Compound Name | 3-anilino-N,N-dimethyl-1-(pyridin-3-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 155879167 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 3-anilino-N,N-dimethyl-1-(pyridin-3-ylmethyl)piperidine-3-carboxamide |
| SMILES | CN(C)C(=O)C1(Nc2ccccc2)CCCN(Cc2cccnc2)C1 |
| InChI | InChI=1S/C20H26N4O/c1-23(2)19(25)20(22-18-9-4-3-5-10-18)11-7-13-24(16-20)15-17-8-6-12-21-14-17/h3-6,8-10,12,14,22H,7,11,13,15-16H2,1-2H3 |
| InChIKey | HAEBQTWDORHCNZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |