C23H29NO — CID 135110130
(4R,5R)-7-[[4-(2-methylphenyl)phenyl]methyl]-7-azaspiro[4.5]decan-4-ol (PubChem CID 135110130) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (4R,5R)-7-[[4-(2-methylphenyl)phenyl]methyl]-7-azaspiro[4.5]decan-4-ol.
| Compound Name | (4R,5R)-7-[[4-(2-methylphenyl)phenyl]methyl]-7-azaspiro[4.5]decan-4-ol |
|---|---|
| PubChem CID | 135110130 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (4R,5R)-7-[[4-(2-methylphenyl)phenyl]methyl]-7-azaspiro[4.5]decan-4-ol |
| SMILES | Cc1ccccc1-c1ccc(CN2CCC[C@]3(CCC[C@H]3O)C2)cc1 |
| InChI | InChI=1S/C23H29NO/c1-18-6-2-3-7-21(18)20-11-9-19(10-12-20)16-24-15-5-14-23(17-24)13-4-8-22(23)25/h2-3,6-7,9-12,22,25H,4-5,8,13-17H2,1H3/t22-,23-/m1/s1 |
| InChIKey | FQYFWUHNWQMNHR-DHIUTWEWSA-N |
| XLogP | 4.79 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |