C20H22N2 — CID 74243723
1-[[4-(2-methylphenyl)phenyl]methyl]piperidine-3-carbonitrile (PubChem CID 74243723) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-[[4-(2-methylphenyl)phenyl]methyl]piperidine-3-carbonitrile.
| Compound Name | 1-[[4-(2-methylphenyl)phenyl]methyl]piperidine-3-carbonitrile |
|---|---|
| PubChem CID | 74243723 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 1-[[4-(2-methylphenyl)phenyl]methyl]piperidine-3-carbonitrile |
| SMILES | Cc1ccccc1-c1ccc(CN2CCCC(C#N)C2)cc1 |
| InChI | InChI=1S/C20H22N2/c1-16-5-2-3-7-20(16)19-10-8-17(9-11-19)14-22-12-4-6-18(13-21)15-22/h2-3,5,7-11,18H,4,6,12,14-15H2,1H3 |
| InChIKey | SHTLELHATDMBQI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |