C16H24N2O2 — CID 165425706
(4R,5R)-7-[(6-methoxy-2-pyridinyl)methyl]-7-azaspiro[4.5]decan-4-ol (PubChem CID 165425706) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (4R,5R)-7-[(6-methoxy-2-pyridinyl)methyl]-7-azaspiro[4.5]decan-4-ol.
| Compound Name | (4R,5R)-7-[(6-methoxy-2-pyridinyl)methyl]-7-azaspiro[4.5]decan-4-ol |
|---|---|
| PubChem CID | 165425706 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (4R,5R)-7-[(6-methoxy-2-pyridinyl)methyl]-7-azaspiro[4.5]decan-4-ol |
| SMILES | COc1cccc(CN2CCC[C@]3(CCC[C@H]3O)C2)n1 |
| InChI | InChI=1S/C16H24N2O2/c1-20-15-7-2-5-13(17-15)11-18-10-4-9-16(12-18)8-3-6-14(16)19/h2,5,7,14,19H,3-4,6,8-12H2,1H3/t14-,16-/m1/s1 |
| InChIKey | MPSPZJTVKWDTET-GDBMZVCRSA-N |
| XLogP | 2.22 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |