C17H24FNO2 — CID 165424895
(4R,5R)-7-[(4-fluoro-2-methoxyphenyl)methyl]-7-azaspiro[4.5]decan-4-ol (PubChem CID 165424895) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is (4R,5R)-7-[(4-fluoro-2-methoxyphenyl)methyl]-7-azaspiro[4.5]decan-4-ol.
| Compound Name | (4R,5R)-7-[(4-fluoro-2-methoxyphenyl)methyl]-7-azaspiro[4.5]decan-4-ol |
|---|---|
| PubChem CID | 165424895 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (4R,5R)-7-[(4-fluoro-2-methoxyphenyl)methyl]-7-azaspiro[4.5]decan-4-ol |
| SMILES | COc1cc(F)ccc1CN1CCC[C@]2(CCC[C@H]2O)C1 |
| InChI | InChI=1S/C17H24FNO2/c1-21-15-10-14(18)6-5-13(15)11-19-9-3-8-17(12-19)7-2-4-16(17)20/h5-6,10,16,20H,2-4,7-9,11-12H2,1H3/t16-,17-/m1/s1 |
| InChIKey | MWNSCMDSPSCNMJ-IAGOWNOFSA-N |
| XLogP | 2.96 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |