C20H31NO4 — CID 154918113
formic acid;(4R,5R)-4-methoxy-7-[(2-methoxy-4-methylphenyl)methyl]-7-azaspiro[4.5]decane (PubChem CID 154918113) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is formic acid;(4R,5R)-4-methoxy-7-[(2-methoxy-4-methylphenyl)methyl]-7-azaspiro[4.5]decane.
| Compound Name | formic acid;(4R,5R)-4-methoxy-7-[(2-methoxy-4-methylphenyl)methyl]-7-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 154918113 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | formic acid;(4R,5R)-4-methoxy-7-[(2-methoxy-4-methylphenyl)methyl]-7-azaspiro[4.5]decane |
| SMILES | COc1cc(C)ccc1CN1CCC[C@]2(CCC[C@H]2OC)C1.O=CO |
| InChI | InChI=1S/C19H29NO2.CH2O2/c1-15-7-8-16(17(12-15)21-2)13-20-11-5-10-19(14-20)9-4-6-18(19)22-3;2-1-3/h7-8,12,18H,4-6,9-11,13-14H2,1-3H3;1H,(H,2,3)/t18-,19-;/m1./s1 |
| InChIKey | KGZYJPUPHXOGJX-STYNFMPRSA-N |
| XLogP | 3.49 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|