C18H32N2O4 — CID 154917887
formic acid;1-[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]-2-piperidin-1-ylethanone (PubChem CID 154917887) has the molecular formula C18H32N2O4 and a molecular weight of 340.46 g/mol. Its IUPAC name is formic acid;1-[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]-2-piperidin-1-ylethanone.
| Compound Name | formic acid;1-[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]-2-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 154917887 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | formic acid;1-[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]-2-piperidin-1-ylethanone |
| SMILES | CO[C@@H]1CCC[C@@]12CCCN(C(=O)CN1CCCCC1)C2.O=CO |
| InChI | InChI=1S/C17H30N2O2.CH2O2/c1-21-15-7-5-8-17(15)9-6-12-19(14-17)16(20)13-18-10-3-2-4-11-18;2-1-3/h15H,2-14H2,1H3;1H,(H,2,3)/t15-,17+;/m1./s1 |
| InChIKey | MGOYKQOCMDBEJS-KALLACGZSA-N |
| XLogP | 1.98 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|