C20H36N2O2 — CID 135104203
N-cyclooctyl-2-[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]acetamide (PubChem CID 135104203) has the molecular formula C20H36N2O2 and a molecular weight of 336.52 g/mol. Its IUPAC name is N-cyclooctyl-2-[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]acetamide.
| Compound Name | N-cyclooctyl-2-[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]acetamide |
|---|---|
| PubChem CID | 135104203 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | N-cyclooctyl-2-[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]acetamide |
| SMILES | CO[C@@H]1CCC[C@@]12CCCN(CC(=O)NC1CCCCCCC1)C2 |
| InChI | InChI=1S/C20H36N2O2/c1-24-18-11-7-12-20(18)13-8-14-22(16-20)15-19(23)21-17-9-5-3-2-4-6-10-17/h17-18H,2-16H2,1H3,(H,21,23)/t18-,20+/m1/s1 |
| InChIKey | IGOUDYUSHWKIHU-QUCCMNQESA-N |
| XLogP | 3.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |