C15H30ClN3O — CID 119922360
N-cyclohexyl-2-[4-(methylaminomethyl)piperidin-1-yl]acetamide;hydrochloride (PubChem CID 119922360) has the molecular formula C15H30ClN3O and a molecular weight of 303.88 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-(methylaminomethyl)piperidin-1-yl]acetamide;hydrochloride.
| Compound Name | N-cyclohexyl-2-[4-(methylaminomethyl)piperidin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119922360 |
| Molecular Formula | C15H30ClN3O |
| Molecular Weight | 303.88 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | N-cyclohexyl-2-[4-(methylaminomethyl)piperidin-1-yl]acetamide;hydrochloride |
| SMILES | CNCC1CCN(CC(=O)NC2CCCCC2)CC1.Cl |
| InChI | InChI=1S/C15H29N3O.ClH/c1-16-11-13-7-9-18(10-8-13)12-15(19)17-14-5-3-2-4-6-14;/h13-14,16H,2-12H2,1H3,(H,17,19);1H |
| InChIKey | WBQISRMLWRTDIO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.88 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |