C11H23ClN4O2 — CID 119922349
2-[4-(methylaminomethyl)piperidin-1-yl]-N-(methylcarbamoyl)acetamide;hydrochloride (PubChem CID 119922349) has the molecular formula C11H23ClN4O2 and a molecular weight of 278.78 g/mol. Its IUPAC name is 2-[4-(methylaminomethyl)piperidin-1-yl]-N-(methylcarbamoyl)acetamide;hydrochloride.
| Compound Name | 2-[4-(methylaminomethyl)piperidin-1-yl]-N-(methylcarbamoyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119922349 |
| Molecular Formula | C11H23ClN4O2 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-[4-(methylaminomethyl)piperidin-1-yl]-N-(methylcarbamoyl)acetamide;hydrochloride |
| SMILES | CNCC1CCN(CC(=O)NC(=O)NC)CC1.Cl |
| InChI | InChI=1S/C11H22N4O2.ClH/c1-12-7-9-3-5-15(6-4-9)8-10(16)14-11(17)13-2;/h9,12H,3-8H2,1-2H3,(H2,13,14,16,17);1H |
| InChIKey | OTMCPLUGYHLEAJ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |