C19H29NO2 — CID 97113551
[(3S)-3-(2-methoxyethyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]piperidin-3-yl]methanol (PubChem CID 97113551) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is [(3S)-3-(2-methoxyethyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]piperidin-3-yl]methanol.
| Compound Name | [(3S)-3-(2-methoxyethyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 97113551 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | [(3S)-3-(2-methoxyethyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]piperidin-3-yl]methanol |
| SMILES | COCC[C@@]1(CO)CCCN(C/C(C)=C/c2ccccc2)C1 |
| InChI | InChI=1S/C19H29NO2/c1-17(13-18-7-4-3-5-8-18)14-20-11-6-9-19(15-20,16-21)10-12-22-2/h3-5,7-8,13,21H,6,9-12,14-16H2,1-2H3/b17-13+/t19-/m0/s1 |
| InChIKey | BMCBCGHVKQFFLH-UMEYKSNOSA-N |
| XLogP | 3.20 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |