C17H24FNO3 — CID 97148386
(3S)-1-[(2-fluoro-5-methylphenyl)methyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid (PubChem CID 97148386) has the molecular formula C17H24FNO3 and a molecular weight of 309.38 g/mol. Its IUPAC name is (3S)-1-[(2-fluoro-5-methylphenyl)methyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[(2-fluoro-5-methylphenyl)methyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97148386 |
| Molecular Formula | C17H24FNO3 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (3S)-1-[(2-fluoro-5-methylphenyl)methyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
| SMILES | COCC[C@@]1(C(=O)O)CCCN(Cc2cc(C)ccc2F)C1 |
| InChI | InChI=1S/C17H24FNO3/c1-13-4-5-15(18)14(10-13)11-19-8-3-6-17(12-19,16(20)21)7-9-22-2/h4-5,10H,3,6-9,11-12H2,1-2H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | PPRUWSMYVFAREK-KRWDZBQOSA-N |
| XLogP | 2.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |