C17H29N3O3 — CID 72904377
1-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid (PubChem CID 72904377) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid.
| Compound Name | 1-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 72904377 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 1-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
| SMILES | COCCC1(C(=O)O)CCCN(Cc2cc(C(C)(C)C)n[nH]2)C1 |
| InChI | InChI=1S/C17H29N3O3/c1-16(2,3)14-10-13(18-19-14)11-20-8-5-6-17(12-20,15(21)22)7-9-23-4/h10H,5-9,11-12H2,1-4H3,(H,18,19)(H,21,22) |
| InChIKey | HPRLPJAEMUUFFH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |