C16H27N3O3 — CID 97117561
(3S)-1-[(3-ethyl-1H-pyrazol-5-yl)methyl]-3-(3-methoxypropyl)piperidine-3-carboxylic acid (PubChem CID 97117561) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is (3S)-1-[(3-ethyl-1H-pyrazol-5-yl)methyl]-3-(3-methoxypropyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[(3-ethyl-1H-pyrazol-5-yl)methyl]-3-(3-methoxypropyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97117561 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (3S)-1-[(3-ethyl-1H-pyrazol-5-yl)methyl]-3-(3-methoxypropyl)piperidine-3-carboxylic acid |
| SMILES | CCc1cc(CN2CCC[C@@](CCCOC)(C(=O)O)C2)[nH]n1 |
| InChI | InChI=1S/C16H27N3O3/c1-3-13-10-14(18-17-13)11-19-8-4-6-16(12-19,15(20)21)7-5-9-22-2/h10H,3-9,11-12H2,1-2H3,(H,17,18)(H,20,21)/t16-/m0/s1 |
| InChIKey | NKWCPTHKDZFWOL-INIZCTEOSA-N |
| XLogP | 2.07 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|