C16H21ClFNO3 — CID 97121145
(3R)-1-[(3-chloro-5-fluorophenyl)methyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid (PubChem CID 97121145) has the molecular formula C16H21ClFNO3 and a molecular weight of 329.80 g/mol. Its IUPAC name is (3R)-1-[(3-chloro-5-fluorophenyl)methyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[(3-chloro-5-fluorophenyl)methyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97121145 |
| Molecular Formula | C16H21ClFNO3 |
| Molecular Weight | 329.80 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (3R)-1-[(3-chloro-5-fluorophenyl)methyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
| SMILES | COCC[C@]1(C(=O)O)CCCN(Cc2cc(F)cc(Cl)c2)C1 |
| InChI | InChI=1S/C16H21ClFNO3/c1-22-6-4-16(15(20)21)3-2-5-19(11-16)10-12-7-13(17)9-14(18)8-12/h7-9H,2-6,10-11H2,1H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | IAJXUTKXGSPOCM-MRXNPFEDSA-N |
| XLogP | 3.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |