C16H21Cl2NO2 — CID 63140602
1-[(2,4-dichlorophenyl)methyl]-3-propylpiperidine-3-carboxylic acid (PubChem CID 63140602) has the molecular formula C16H21Cl2NO2 and a molecular weight of 330.25 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-propylpiperidine-3-carboxylic acid.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-propylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63140602 |
| Molecular Formula | C16H21Cl2NO2 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-propylpiperidine-3-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCCN(Cc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C16H21Cl2NO2/c1-2-6-16(15(20)21)7-3-8-19(11-16)10-12-4-5-13(17)9-14(12)18/h4-5,9H,2-3,6-8,10-11H2,1H3,(H,20,21) |
| InChIKey | OVJZBXCLLIKREM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |