C15H19ClFNO2 — CID 102616840
1-[(2-chloro-5-fluorophenyl)methyl]-3-ethylpiperidine-3-carboxylic acid (PubChem CID 102616840) has the molecular formula C15H19ClFNO2 and a molecular weight of 299.77 g/mol. Its IUPAC name is 1-[(2-chloro-5-fluorophenyl)methyl]-3-ethylpiperidine-3-carboxylic acid.
| Compound Name | 1-[(2-chloro-5-fluorophenyl)methyl]-3-ethylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 102616840 |
| Molecular Formula | C15H19ClFNO2 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 1-[(2-chloro-5-fluorophenyl)methyl]-3-ethylpiperidine-3-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCCN(Cc2cc(F)ccc2Cl)C1 |
| InChI | InChI=1S/C15H19ClFNO2/c1-2-15(14(19)20)6-3-7-18(10-15)9-11-8-12(17)4-5-13(11)16/h4-5,8H,2-3,6-7,9-10H2,1H3,(H,19,20) |
| InChIKey | CRXUCWPWHKGWDF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |