C16H23NO4 — CID 65068460
1-[(3,4-dihydroxyphenyl)methyl]-3-propylpiperidine-3-carboxylic acid (PubChem CID 65068460) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 1-[(3,4-dihydroxyphenyl)methyl]-3-propylpiperidine-3-carboxylic acid.
| Compound Name | 1-[(3,4-dihydroxyphenyl)methyl]-3-propylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 65068460 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1-[(3,4-dihydroxyphenyl)methyl]-3-propylpiperidine-3-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCCN(Cc2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C16H23NO4/c1-2-6-16(15(20)21)7-3-8-17(11-16)10-12-4-5-13(18)14(19)9-12/h4-5,9,18-19H,2-3,6-8,10-11H2,1H3,(H,20,21) |
| InChIKey | QRMUGXUTVGBTNA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|