C17H25NO5 — CID 97120972
(3S)-1-(2,5-dimethylfuran-3-carbonyl)-3-(3-methoxypropyl)piperidine-3-carboxylic acid (PubChem CID 97120972) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is (3S)-1-(2,5-dimethylfuran-3-carbonyl)-3-(3-methoxypropyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(2,5-dimethylfuran-3-carbonyl)-3-(3-methoxypropyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97120972 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (3S)-1-(2,5-dimethylfuran-3-carbonyl)-3-(3-methoxypropyl)piperidine-3-carboxylic acid |
| SMILES | COCCC[C@@]1(C(=O)O)CCCN(C(=O)c2cc(C)oc2C)C1 |
| InChI | InChI=1S/C17H25NO5/c1-12-10-14(13(2)23-12)15(19)18-8-4-6-17(11-18,16(20)21)7-5-9-22-3/h10H,4-9,11H2,1-3H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | KKXVAUGYPLSBDI-KRWDZBQOSA-N |
| XLogP | 2.63 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|