C19H25N3O4 — CID 97137422
(3S)-3-(3-methoxypropyl)-1-(2-methyl-3H-benzimidazole-5-carbonyl)piperidine-3-carboxylic acid (PubChem CID 97137422) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is (3S)-3-(3-methoxypropyl)-1-(2-methyl-3H-benzimidazole-5-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-3-(3-methoxypropyl)-1-(2-methyl-3H-benzimidazole-5-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97137422 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (3S)-3-(3-methoxypropyl)-1-(2-methyl-3H-benzimidazole-5-carbonyl)piperidine-3-carboxylic acid |
| SMILES | COCCC[C@@]1(C(=O)O)CCCN(C(=O)c2ccc3nc(C)[nH]c3c2)C1 |
| InChI | InChI=1S/C19H25N3O4/c1-13-20-15-6-5-14(11-16(15)21-13)17(23)22-9-3-7-19(12-22,18(24)25)8-4-10-26-2/h5-6,11H,3-4,7-10,12H2,1-2H3,(H,20,21)(H,24,25)/t19-/m0/s1 |
| InChIKey | KZBUUUSYMVODOL-IBGZPJMESA-N |
| XLogP | 2.60 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|