C18H28N2O4 — CID 97137291
(3R)-1-(1-tert-butylpyrrole-3-carbonyl)-3-(2-methoxyethyl)piperidine-3-carboxylic acid (PubChem CID 97137291) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is (3R)-1-(1-tert-butylpyrrole-3-carbonyl)-3-(2-methoxyethyl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-(1-tert-butylpyrrole-3-carbonyl)-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97137291 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (3R)-1-(1-tert-butylpyrrole-3-carbonyl)-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
| SMILES | COCC[C@]1(C(=O)O)CCCN(C(=O)c2ccn(C(C)(C)C)c2)C1 |
| InChI | InChI=1S/C18H28N2O4/c1-17(2,3)20-10-6-14(12-20)15(21)19-9-5-7-18(13-19,16(22)23)8-11-24-4/h6,10,12H,5,7-9,11,13H2,1-4H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | DVNAVYDEQDRIKI-GOSISDBHSA-N |
| XLogP | 2.59 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |