C20H28N4O2 — CID 110098110
[4-hydroxy-4-(pyrrolidin-1-ylmethyl)azepan-1-yl]-(2-methyl-3H-benzimidazol-5-yl)methanone (PubChem CID 110098110) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is [4-hydroxy-4-(pyrrolidin-1-ylmethyl)azepan-1-yl]-(2-methyl-3H-benzimidazol-5-yl)methanone.
| Compound Name | [4-hydroxy-4-(pyrrolidin-1-ylmethyl)azepan-1-yl]-(2-methyl-3H-benzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 110098110 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | [4-hydroxy-4-(pyrrolidin-1-ylmethyl)azepan-1-yl]-(2-methyl-3H-benzimidazol-5-yl)methanone |
| SMILES | Cc1nc2ccc(C(=O)N3CCCC(O)(CN4CCCC4)CC3)cc2[nH]1 |
| InChI | InChI=1S/C20H28N4O2/c1-15-21-17-6-5-16(13-18(17)22-15)19(25)24-11-4-7-20(26,8-12-24)14-23-9-2-3-10-23/h5-6,13,26H,2-4,7-12,14H2,1H3,(H,21,22) |
| InChIKey | NLMNKTBIYCQELJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |