C18H25N5O3 — CID 125008475
2H-benzotriazol-5-yl-[(4S)-4-hydroxy-4-(morpholin-4-ylmethyl)azepan-1-yl]methanone (PubChem CID 125008475) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2H-benzotriazol-5-yl-[(4S)-4-hydroxy-4-(morpholin-4-ylmethyl)azepan-1-yl]methanone.
| Compound Name | 2H-benzotriazol-5-yl-[(4S)-4-hydroxy-4-(morpholin-4-ylmethyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 125008475 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 2H-benzotriazol-5-yl-[(4S)-4-hydroxy-4-(morpholin-4-ylmethyl)azepan-1-yl]methanone |
| SMILES | O=C(c1ccc2n[nH]nc2c1)N1CCC[C@@](O)(CN2CCOCC2)CC1 |
| InChI | InChI=1S/C18H25N5O3/c24-17(14-2-3-15-16(12-14)20-21-19-15)23-6-1-4-18(25,5-7-23)13-22-8-10-26-11-9-22/h2-3,12,25H,1,4-11,13H2,(H,19,20,21)/t18-/m0/s1 |
| InChIKey | UVDXBGJZTCMQEF-SFHVURJKSA-N |
| XLogP | 0.65 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |