C14H22F3NO4 — CID 97128216
(3S)-3-(3-methoxypropyl)-1-(4,4,4-trifluorobutanoyl)piperidine-3-carboxylic acid (PubChem CID 97128216) has the molecular formula C14H22F3NO4 and a molecular weight of 325.33 g/mol. Its IUPAC name is (3S)-3-(3-methoxypropyl)-1-(4,4,4-trifluorobutanoyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-3-(3-methoxypropyl)-1-(4,4,4-trifluorobutanoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97128216 |
| Molecular Formula | C14H22F3NO4 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (3S)-3-(3-methoxypropyl)-1-(4,4,4-trifluorobutanoyl)piperidine-3-carboxylic acid |
| SMILES | COCCC[C@@]1(C(=O)O)CCCN(C(=O)CCC(F)(F)F)C1 |
| InChI | InChI=1S/C14H22F3NO4/c1-22-9-3-6-13(12(20)21)5-2-8-18(10-13)11(19)4-7-14(15,16)17/h2-10H2,1H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | UQUFKOPWXRPYQF-ZDUSSCGKSA-N |
| XLogP | 2.45 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|