C22H31N3O3 — CID 42460285
ethyl (3S)-1-[(1-ethylpyrazol-4-yl)methyl]-3-(2-phenoxyethyl)piperidine-3-carboxylate (PubChem CID 42460285) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is ethyl (3S)-1-[(1-ethylpyrazol-4-yl)methyl]-3-(2-phenoxyethyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(1-ethylpyrazol-4-yl)methyl]-3-(2-phenoxyethyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42460285 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | ethyl (3S)-1-[(1-ethylpyrazol-4-yl)methyl]-3-(2-phenoxyethyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(CCOc2ccccc2)CCCN(Cc2cnn(CC)c2)C1 |
| InChI | InChI=1S/C22H31N3O3/c1-3-25-17-19(15-23-25)16-24-13-8-11-22(18-24,21(26)27-4-2)12-14-28-20-9-6-5-7-10-20/h5-7,9-10,15,17H,3-4,8,11-14,16,18H2,1-2H3/t22-/m0/s1 |
| InChIKey | ROAWKXSUXRAJCX-QFIPXVFZSA-N |
| XLogP | 3.52 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |