C21H25N3O4 — CID 42212234
ethyl (3R)-3-(2-phenoxyethyl)-1-(pyrazine-2-carbonyl)piperidine-3-carboxylate (PubChem CID 42212234) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is ethyl (3R)-3-(2-phenoxyethyl)-1-(pyrazine-2-carbonyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-3-(2-phenoxyethyl)-1-(pyrazine-2-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42212234 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | ethyl (3R)-3-(2-phenoxyethyl)-1-(pyrazine-2-carbonyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(CCOc2ccccc2)CCCN(C(=O)c2cnccn2)C1 |
| InChI | InChI=1S/C21H25N3O4/c1-2-27-20(26)21(10-14-28-17-7-4-3-5-8-17)9-6-13-24(16-21)19(25)18-15-22-11-12-23-18/h3-5,7-8,11-12,15H,2,6,9-10,13-14,16H2,1H3/t21-/m1/s1 |
| InChIKey | WTZYQLXLVGODCJ-OAQYLSRUSA-N |
| XLogP | 2.73 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |