C22H26N2O5 — CID 25299134
ethyl (3R)-1-(1-oxidopyridin-1-ium-3-carbonyl)-3-(2-phenoxyethyl)piperidine-3-carboxylate (PubChem CID 25299134) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is ethyl (3R)-1-(1-oxidopyridin-1-ium-3-carbonyl)-3-(2-phenoxyethyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(1-oxidopyridin-1-ium-3-carbonyl)-3-(2-phenoxyethyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 25299134 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | ethyl (3R)-1-(1-oxidopyridin-1-ium-3-carbonyl)-3-(2-phenoxyethyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(CCOc2ccccc2)CCCN(C(=O)c2ccc[n+]([O-])c2)C1 |
| InChI | InChI=1S/C22H26N2O5/c1-2-28-21(26)22(12-15-29-19-9-4-3-5-10-19)11-7-13-23(17-22)20(25)18-8-6-14-24(27)16-18/h3-6,8-10,14,16H,2,7,11-13,15,17H2,1H3/t22-/m1/s1 |
| InChIKey | AJGGESKXOSATIT-JOCHJYFZSA-N |
| XLogP | 2.57 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|