C26H31N3O3 — CID 25454150
ethyl 4-(2-phenoxyethyl)-1-[(1-phenylpyrazol-4-yl)methyl]piperidine-4-carboxylate (PubChem CID 25454150) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is ethyl 4-(2-phenoxyethyl)-1-[(1-phenylpyrazol-4-yl)methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 4-(2-phenoxyethyl)-1-[(1-phenylpyrazol-4-yl)methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 25454150 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | ethyl 4-(2-phenoxyethyl)-1-[(1-phenylpyrazol-4-yl)methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(CCOc2ccccc2)CCN(Cc2cnn(-c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C26H31N3O3/c1-2-31-25(30)26(15-18-32-24-11-7-4-8-12-24)13-16-28(17-14-26)20-22-19-27-29(21-22)23-9-5-3-6-10-23/h3-12,19,21H,2,13-18,20H2,1H3 |
| InChIKey | DUFRKIILLAPVCP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |