C24H32N2O3 — CID 42516933
ethyl 4-(2-phenoxyethyl)-1-[(2S)-1-pyridin-3-ylpropan-2-yl]piperidine-4-carboxylate (PubChem CID 42516933) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is ethyl 4-(2-phenoxyethyl)-1-[(2S)-1-pyridin-3-ylpropan-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 4-(2-phenoxyethyl)-1-[(2S)-1-pyridin-3-ylpropan-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42516933 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | ethyl 4-(2-phenoxyethyl)-1-[(2S)-1-pyridin-3-ylpropan-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(CCOc2ccccc2)CCN([C@@H](C)Cc2cccnc2)CC1 |
| InChI | InChI=1S/C24H32N2O3/c1-3-28-23(27)24(13-17-29-22-9-5-4-6-10-22)11-15-26(16-12-24)20(2)18-21-8-7-14-25-19-21/h4-10,14,19-20H,3,11-13,15-18H2,1-2H3/t20-/m0/s1 |
| InChIKey | DHMZKLLRYASWTB-FQEVSTJZSA-N |
| XLogP | 4.13 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |