C21H27NO5S2 — CID 26410876
ethyl 1-(5-methylthiophen-2-yl)sulfonyl-4-(2-phenoxyethyl)piperidine-4-carboxylate (PubChem CID 26410876) has the molecular formula C21H27NO5S2 and a molecular weight of 437.58 g/mol. Its IUPAC name is ethyl 1-(5-methylthiophen-2-yl)sulfonyl-4-(2-phenoxyethyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(5-methylthiophen-2-yl)sulfonyl-4-(2-phenoxyethyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 26410876 |
| Molecular Formula | C21H27NO5S2 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | ethyl 1-(5-methylthiophen-2-yl)sulfonyl-4-(2-phenoxyethyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(CCOc2ccccc2)CCN(S(=O)(=O)c2ccc(C)s2)CC1 |
| InChI | InChI=1S/C21H27NO5S2/c1-3-26-20(23)21(13-16-27-18-7-5-4-6-8-18)11-14-22(15-12-21)29(24,25)19-10-9-17(2)28-19/h4-10H,3,11-16H2,1-2H3 |
| InChIKey | JVZBQDKDQUYFTH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |