C24H32N2O2 — CID 31134180
ethyl 4-(2-phenylethyl)-1-[(2S)-1-pyridin-3-ylpropan-2-yl]piperidine-4-carboxylate (PubChem CID 31134180) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is ethyl 4-(2-phenylethyl)-1-[(2S)-1-pyridin-3-ylpropan-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 4-(2-phenylethyl)-1-[(2S)-1-pyridin-3-ylpropan-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 31134180 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | ethyl 4-(2-phenylethyl)-1-[(2S)-1-pyridin-3-ylpropan-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(CCc2ccccc2)CCN([C@@H](C)Cc2cccnc2)CC1 |
| InChI | InChI=1S/C24H32N2O2/c1-3-28-23(27)24(12-11-21-8-5-4-6-9-21)13-16-26(17-14-24)20(2)18-22-10-7-15-25-19-22/h4-10,15,19-20H,3,11-14,16-18H2,1-2H3/t20-/m0/s1 |
| InChIKey | NTOAAHCDTIBVRJ-FQEVSTJZSA-N |
| XLogP | 4.29 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |