C22H28N2O2 — CID 42291340
ethyl (3S)-3-(2-phenylethyl)-1-(pyridin-2-ylmethyl)piperidine-3-carboxylate (PubChem CID 42291340) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is ethyl (3S)-3-(2-phenylethyl)-1-(pyridin-2-ylmethyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-3-(2-phenylethyl)-1-(pyridin-2-ylmethyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42291340 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | ethyl (3S)-3-(2-phenylethyl)-1-(pyridin-2-ylmethyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(CCc2ccccc2)CCCN(Cc2ccccn2)C1 |
| InChI | InChI=1S/C22H28N2O2/c1-2-26-21(25)22(14-12-19-9-4-3-5-10-19)13-8-16-24(18-22)17-20-11-6-7-15-23-20/h3-7,9-11,15H,2,8,12-14,16-18H2,1H3/t22-/m1/s1 |
| InChIKey | GXOZLIWSAHCFHH-JOCHJYFZSA-N |
| XLogP | 3.86 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |