C21H29N3O2 — CID 26411319
ethyl (3S)-3-benzyl-1-[(1-ethylimidazol-2-yl)methyl]piperidine-3-carboxylate (PubChem CID 26411319) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is ethyl (3S)-3-benzyl-1-[(1-ethylimidazol-2-yl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-3-benzyl-1-[(1-ethylimidazol-2-yl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 26411319 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | ethyl (3S)-3-benzyl-1-[(1-ethylimidazol-2-yl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(Cc2ccccc2)CCCN(Cc2nccn2CC)C1 |
| InChI | InChI=1S/C21H29N3O2/c1-3-24-14-12-22-19(24)16-23-13-8-11-21(17-23,20(25)26-4-2)15-18-9-6-5-7-10-18/h5-7,9-10,12,14H,3-4,8,11,13,15-17H2,1-2H3/t21-/m0/s1 |
| InChIKey | TXAVDMMOIRSBPZ-NRFANRHFSA-N |
| XLogP | 3.29 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |