C22H28N2O3 — CID 42395681
ethyl (3R)-3-[(3-methoxyphenyl)methyl]-1-(pyridin-4-ylmethyl)piperidine-3-carboxylate (PubChem CID 42395681) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is ethyl (3R)-3-[(3-methoxyphenyl)methyl]-1-(pyridin-4-ylmethyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-3-[(3-methoxyphenyl)methyl]-1-(pyridin-4-ylmethyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42395681 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | ethyl (3R)-3-[(3-methoxyphenyl)methyl]-1-(pyridin-4-ylmethyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2cccc(OC)c2)CCCN(Cc2ccncc2)C1 |
| InChI | InChI=1S/C22H28N2O3/c1-3-27-21(25)22(15-19-6-4-7-20(14-19)26-2)10-5-13-24(17-22)16-18-8-11-23-12-9-18/h4,6-9,11-12,14H,3,5,10,13,15-17H2,1-2H3/t22-/m1/s1 |
| InChIKey | HBZPFSZYZUTRHF-JOCHJYFZSA-N |
| XLogP | 3.48 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |