C22H26N2O4 — CID 25371387
ethyl (3S)-3-[(3-methoxyphenyl)methyl]-1-(pyridine-4-carbonyl)piperidine-3-carboxylate (PubChem CID 25371387) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is ethyl (3S)-3-[(3-methoxyphenyl)methyl]-1-(pyridine-4-carbonyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-3-[(3-methoxyphenyl)methyl]-1-(pyridine-4-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 25371387 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | ethyl (3S)-3-[(3-methoxyphenyl)methyl]-1-(pyridine-4-carbonyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(Cc2cccc(OC)c2)CCCN(C(=O)c2ccncc2)C1 |
| InChI | InChI=1S/C22H26N2O4/c1-3-28-21(26)22(15-17-6-4-7-19(14-17)27-2)10-5-13-24(16-22)20(25)18-8-11-23-12-9-18/h4,6-9,11-12,14H,3,5,10,13,15-16H2,1-2H3/t22-/m0/s1 |
| InChIKey | NCCRIOFHGLGVNP-QFIPXVFZSA-N |
| XLogP | 3.12 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |