C27H33NO4 — CID 45195623
ethyl 1-[[4-(4-hydroxybut-1-ynyl)phenyl]methyl]-3-[(3-methoxyphenyl)methyl]piperidine-3-carboxylate (PubChem CID 45195623) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is ethyl 1-[[4-(4-hydroxybut-1-ynyl)phenyl]methyl]-3-[(3-methoxyphenyl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[[4-(4-hydroxybut-1-ynyl)phenyl]methyl]-3-[(3-methoxyphenyl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 45195623 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | ethyl 1-[[4-(4-hydroxybut-1-ynyl)phenyl]methyl]-3-[(3-methoxyphenyl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1(Cc2cccc(OC)c2)CCCN(Cc2ccc(C#CCCO)cc2)C1 |
| InChI | InChI=1S/C27H33NO4/c1-3-32-26(30)27(19-24-9-6-10-25(18-24)31-2)15-7-16-28(21-27)20-23-13-11-22(12-14-23)8-4-5-17-29/h6,9-14,18,29H,3,5,7,15-17,19-21H2,1-2H3 |
| InChIKey | OEZZOSIZMKITRX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|