C17H26N2O3 — CID 45180720
ethyl 3-(2-methoxyethyl)-1-(pyridin-2-ylmethyl)piperidine-3-carboxylate (PubChem CID 45180720) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is ethyl 3-(2-methoxyethyl)-1-(pyridin-2-ylmethyl)piperidine-3-carboxylate.
| Compound Name | ethyl 3-(2-methoxyethyl)-1-(pyridin-2-ylmethyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 45180720 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | ethyl 3-(2-methoxyethyl)-1-(pyridin-2-ylmethyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1(CCOC)CCCN(Cc2ccccn2)C1 |
| InChI | InChI=1S/C17H26N2O3/c1-3-22-16(20)17(9-12-21-2)8-6-11-19(14-17)13-15-7-4-5-10-18-15/h4-5,7,10H,3,6,8-9,11-14H2,1-2H3 |
| InChIKey | KLOOWNHZEHAOFU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |