C18H25NO5 — CID 122033905
3-[[3-ethoxycarbonyl-3-(methoxymethyl)piperidin-1-yl]methyl]benzoic acid (PubChem CID 122033905) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 3-[[3-ethoxycarbonyl-3-(methoxymethyl)piperidin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[3-ethoxycarbonyl-3-(methoxymethyl)piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122033905 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3-[[3-ethoxycarbonyl-3-(methoxymethyl)piperidin-1-yl]methyl]benzoic acid |
| SMILES | CCOC(=O)C1(COC)CCCN(Cc2cccc(C(=O)O)c2)C1 |
| InChI | InChI=1S/C18H25NO5/c1-3-24-17(22)18(13-23-2)8-5-9-19(12-18)11-14-6-4-7-15(10-14)16(20)21/h4,6-7,10H,3,5,8-9,11-13H2,1-2H3,(H,20,21) |
| InChIKey | YMIPQOKHQREOHY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |