C24H29NO3 — CID 26411542
ethyl 1-[(3-acetylphenyl)methyl]-4-benzylpiperidine-4-carboxylate (PubChem CID 26411542) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is ethyl 1-[(3-acetylphenyl)methyl]-4-benzylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[(3-acetylphenyl)methyl]-4-benzylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 26411542 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | ethyl 1-[(3-acetylphenyl)methyl]-4-benzylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccccc2)CCN(Cc2cccc(C(C)=O)c2)CC1 |
| InChI | InChI=1S/C24H29NO3/c1-3-28-23(27)24(17-20-8-5-4-6-9-20)12-14-25(15-13-24)18-21-10-7-11-22(16-21)19(2)26/h4-11,16H,3,12-15,17-18H2,1-2H3 |
| InChIKey | QYHYUIPEXGFEOH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |