C18H24O4 — CID 59218761
ethyl 8-benzyl-1,4-dioxaspiro[4.5]decane-8-carboxylate (PubChem CID 59218761) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is ethyl 8-benzyl-1,4-dioxaspiro[4.5]decane-8-carboxylate.
| Compound Name | ethyl 8-benzyl-1,4-dioxaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 59218761 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | ethyl 8-benzyl-1,4-dioxaspiro[4.5]decane-8-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccccc2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C18H24O4/c1-2-20-16(19)17(14-15-6-4-3-5-7-15)8-10-18(11-9-17)21-12-13-22-18/h3-7H,2,8-14H2,1H3 |
| InChIKey | PKFCBCFBKADPKA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |