C27H30LiNO4 — CID 173126199
lithium;3-[[3,3-bis(4-methoxyphenyl)piperidin-1-yl]methyl]benzoic acid;hydride (PubChem CID 173126199) has the molecular formula C27H30LiNO4 and a molecular weight of 439.48 g/mol. Its IUPAC name is lithium;3-[[3,3-bis(4-methoxyphenyl)piperidin-1-yl]methyl]benzoic acid;hydride.
| Compound Name | lithium;3-[[3,3-bis(4-methoxyphenyl)piperidin-1-yl]methyl]benzoic acid;hydride |
|---|---|
| PubChem CID | 173126199 |
| Molecular Formula | C27H30LiNO4 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | lithium;3-[[3,3-bis(4-methoxyphenyl)piperidin-1-yl]methyl]benzoic acid;hydride |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)CCCN(Cc3cccc(C(=O)O)c3)C2)cc1.[H-].[Li+] |
| InChI | InChI=1S/C27H29NO4.Li.H/c1-31-24-11-7-22(8-12-24)27(23-9-13-25(32-2)14-10-23)15-4-16-28(19-27)18-20-5-3-6-21(17-20)26(29)30;;/h3,5-14,17H,4,15-16,18-19H2,1-2H3,(H,29,30);;/q;+1;-1 |
| InChIKey | MDFNRYFDHXFKIM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |