C18H19NO3 — CID 122031051
3-[[[1-(4-methoxyphenyl)cyclopropyl]amino]methyl]benzoic acid (PubChem CID 122031051) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-[[[1-(4-methoxyphenyl)cyclopropyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[1-(4-methoxyphenyl)cyclopropyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122031051 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3-[[[1-(4-methoxyphenyl)cyclopropyl]amino]methyl]benzoic acid |
| SMILES | COc1ccc(C2(NCc3cccc(C(=O)O)c3)CC2)cc1 |
| InChI | InChI=1S/C18H19NO3/c1-22-16-7-5-15(6-8-16)18(9-10-18)19-12-13-3-2-4-14(11-13)17(20)21/h2-8,11,19H,9-10,12H2,1H3,(H,20,21) |
| InChIKey | OOWZTHKUAGYPJX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |