C21H25FN2O2 — CID 46966662
N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-1-(4-methoxyphenyl)cyclopropan-1-amine (PubChem CID 46966662) has the molecular formula C21H25FN2O2 and a molecular weight of 356.44 g/mol. Its IUPAC name is N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-1-(4-methoxyphenyl)cyclopropan-1-amine.
| Compound Name | N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-1-(4-methoxyphenyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 46966662 |
| Molecular Formula | C21H25FN2O2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-1-(4-methoxyphenyl)cyclopropan-1-amine |
| SMILES | COc1ccc(C2(NCc3ccc(N4CCOCC4)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C21H25FN2O2/c1-25-18-5-3-17(4-6-18)21(8-9-21)23-15-16-2-7-20(19(22)14-16)24-10-12-26-13-11-24/h2-7,14,23H,8-13,15H2,1H3 |
| InChIKey | YHZPGOQPCWOXRX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|