C18H21ClN2O2 — CID 91674330
5-chloro-N-[(4-methoxyphenyl)methyl]-2-morpholin-4-ylaniline (PubChem CID 91674330) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is 5-chloro-N-[(4-methoxyphenyl)methyl]-2-morpholin-4-ylaniline.
| Compound Name | 5-chloro-N-[(4-methoxyphenyl)methyl]-2-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 91674330 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 5-chloro-N-[(4-methoxyphenyl)methyl]-2-morpholin-4-ylaniline |
| SMILES | COc1ccc(CNc2cc(Cl)ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H21ClN2O2/c1-22-16-5-2-14(3-6-16)13-20-17-12-15(19)4-7-18(17)21-8-10-23-11-9-21/h2-7,12,20H,8-11,13H2,1H3 |
| InChIKey | LLIPTXUYRSTSPH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |