C30H36N2O2 — CID 12968707
4-[1-benzyl-3-(3-methoxyphenyl)piperidin-3-yl]-N,N-diethylbenzamide (PubChem CID 12968707) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is 4-[1-benzyl-3-(3-methoxyphenyl)piperidin-3-yl]-N,N-diethylbenzamide.
| Compound Name | 4-[1-benzyl-3-(3-methoxyphenyl)piperidin-3-yl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 12968707 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 4-[1-benzyl-3-(3-methoxyphenyl)piperidin-3-yl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C2(c3cccc(OC)c3)CCCN(Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C30H36N2O2/c1-4-32(5-2)29(33)25-15-17-26(18-16-25)30(27-13-9-14-28(21-27)34-3)19-10-20-31(23-30)22-24-11-7-6-8-12-24/h6-9,11-18,21H,4-5,10,19-20,22-23H2,1-3H3 |
| InChIKey | DFFNVGBCGQYEHN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |